Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1-(n-Butyl)imidazole, 99%
CAS: 4316-42-1 Molecular Formula: C7H12N2 Molecular Weight (g/mol): 124.19 MDL Number: MFCD00042753 InChI Key: MCMFEZDRQOJKMN-UHFFFAOYSA-N Synonym: 1-butyl-1h-imidazole,1h-imidazole, 1-butyl,n-butylimidazole,1-n-butylimidazole,n-n-butyl imidazole,1-n-butyl imidazole,1-buthylimidazole,n-n-butylimidazole,imidazole, 1-butyl PubChem CID: 61347 IUPAC Name: 1-butyl-1H-imidazole SMILES: CCCCN1C=CN=C1
| PubChem CID | 61347 |
|---|---|
| CAS | 4316-42-1 |
| Molecular Weight (g/mol) | 124.19 |
| MDL Number | MFCD00042753 |
| SMILES | CCCCN1C=CN=C1 |
| Synonym | 1-butyl-1h-imidazole,1h-imidazole, 1-butyl,n-butylimidazole,1-n-butylimidazole,n-n-butyl imidazole,1-n-butyl imidazole,1-buthylimidazole,n-n-butylimidazole,imidazole, 1-butyl |
| IUPAC Name | 1-butyl-1H-imidazole |
| InChI Key | MCMFEZDRQOJKMN-UHFFFAOYSA-N |
| Molecular Formula | C7H12N2 |
Benzimidazole-5,6-dicarboxylic acid, 97%
CAS: 10351-75-4 Molecular Formula: C9H6N2O4 Molecular Weight (g/mol): 206.16 MDL Number: MFCD03093058 InChI Key: PIPQOFRJDBZPFR-UHFFFAOYSA-N Synonym: benzimidazole-5,6-dicarboxylic acid,1h-benzo d imidazole-5,6-dicarboxylic acid,1h-1,3-benzodiazole-5,6-dicarboxylic acid,1h-benzoimidazole-5,6-dicarboxylic,1h-benzoimidazole-5,6-dicarboxylic acid,acmc-1bsyc,5,6-benzimidazoledicarboxylic acid,benzo d imidazole-5,6-dicarboxylic acid PubChem CID: 7023591 IUPAC Name: 1H-benzimidazole-5,6-dicarboxylic acid SMILES: OC(=O)C1=C(C=C2N=CNC2=C1)C(O)=O
| PubChem CID | 7023591 |
|---|---|
| CAS | 10351-75-4 |
| Molecular Weight (g/mol) | 206.16 |
| MDL Number | MFCD03093058 |
| SMILES | OC(=O)C1=C(C=C2N=CNC2=C1)C(O)=O |
| Synonym | benzimidazole-5,6-dicarboxylic acid,1h-benzo d imidazole-5,6-dicarboxylic acid,1h-1,3-benzodiazole-5,6-dicarboxylic acid,1h-benzoimidazole-5,6-dicarboxylic,1h-benzoimidazole-5,6-dicarboxylic acid,acmc-1bsyc,5,6-benzimidazoledicarboxylic acid,benzo d imidazole-5,6-dicarboxylic acid |
| IUPAC Name | 1H-benzimidazole-5,6-dicarboxylic acid |
| InChI Key | PIPQOFRJDBZPFR-UHFFFAOYSA-N |
| Molecular Formula | C9H6N2O4 |
trans-1-Octenylboronic acid pinacol ester, 97%, Thermo Scientific Chemicals
CAS: 83947-55-1 Molecular Formula: C14H27BO2 Molecular Weight (g/mol): 238.178 MDL Number: MFCD03453667 InChI Key: KQTOSGTXAFJZSJ-VAWYXSNFSA-N Synonym: trans-4,4,5,5-tetramethyl-2-oct-1-enyl-1,3,2-dioxaborolane,1-octenylboronic acid pinacol ester,1-octen-1-ylboronic acid, pinacol ester,trans-1-octenylboronic acid pinacol ester,trans-4,4,5,5-tetramethyl-2-1-octenyl-1,3,2-dioxaborolane,e-1-octenylboronic acid pinacol ester,trans-1-octen-1-ylboronic acid pinacol ester,trans-1-oct-1-en-1-yl boronic acid, pinacol ester,trans-4,4,5,5-tetramethyl-2-oct-1-en-1-yl-1,3,2-dioxaborolane PubChem CID: 5706555 IUPAC Name: 4,4,5,5-tetramethyl-2-[(E)-oct-1-enyl]-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C=CCCCCCC
| PubChem CID | 5706555 |
|---|---|
| CAS | 83947-55-1 |
| Molecular Weight (g/mol) | 238.178 |
| MDL Number | MFCD03453667 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=CCCCCCC |
| Synonym | trans-4,4,5,5-tetramethyl-2-oct-1-enyl-1,3,2-dioxaborolane,1-octenylboronic acid pinacol ester,1-octen-1-ylboronic acid, pinacol ester,trans-1-octenylboronic acid pinacol ester,trans-4,4,5,5-tetramethyl-2-1-octenyl-1,3,2-dioxaborolane,e-1-octenylboronic acid pinacol ester,trans-1-octen-1-ylboronic acid pinacol ester,trans-1-oct-1-en-1-yl boronic acid, pinacol ester,trans-4,4,5,5-tetramethyl-2-oct-1-en-1-yl-1,3,2-dioxaborolane |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-oct-1-enyl]-1,3,2-dioxaborolane |
| InChI Key | KQTOSGTXAFJZSJ-VAWYXSNFSA-N |
| Molecular Formula | C14H27BO2 |
2-Chloroethanesulfonyl chloride, 95%
CAS: 1622-32-8 Molecular Formula: C2H4Cl2O2S Molecular Weight (g/mol): 163.02 MDL Number: MFCD00007461 InChI Key: VHCSBTPOPKFYIU-UHFFFAOYSA-N Synonym: 2-chloroethyl sulphonyl chloride,2-chloroethylsulfonyl chloride,ethanesulfonyl chloride, 2-chloro,2-chloroethane sulfochloride,2-chloro-ethanesulfonyl chloride,2-chloroethanesulfonylchloride,beta-chloroethanesulfonyl chloride,2-chloroethane-1-sulfonyl chloride,ethanesulfonylchloride, 2-chloro,2-chloro-1-ethanesulfonyl chloride PubChem CID: 15385 IUPAC Name: 2-chloroethanesulfonyl chloride SMILES: C(CCl)S(=O)(=O)Cl
| PubChem CID | 15385 |
|---|---|
| CAS | 1622-32-8 |
| Molecular Weight (g/mol) | 163.02 |
| MDL Number | MFCD00007461 |
| SMILES | C(CCl)S(=O)(=O)Cl |
| Synonym | 2-chloroethyl sulphonyl chloride,2-chloroethylsulfonyl chloride,ethanesulfonyl chloride, 2-chloro,2-chloroethane sulfochloride,2-chloro-ethanesulfonyl chloride,2-chloroethanesulfonylchloride,beta-chloroethanesulfonyl chloride,2-chloroethane-1-sulfonyl chloride,ethanesulfonylchloride, 2-chloro,2-chloro-1-ethanesulfonyl chloride |
| IUPAC Name | 2-chloroethanesulfonyl chloride |
| InChI Key | VHCSBTPOPKFYIU-UHFFFAOYSA-N |
| Molecular Formula | C2H4Cl2O2S |
1,2-Cyclohexanedicarboxylic anhydride, cis + trans, 97%
CAS: 85-42-7 Molecular Formula: C8H10O3 Molecular Weight (g/mol): 154.17 MDL Number: MFCD00064863,MFCD00674195 InChI Key: MUTGBJKUEZFXGO-UHFFFAOYNA-N Synonym: hexahydrophthalic anhydride,hexahydroisobenzofuran-1,3-dione,hhpa,1,2-cyclohexanedicarboxylic anhydride,lekutherm hardener h,hexahydrophthalic acid anhydride,1,3-isobenzofurandione, hexahydro,araldite ht 907,cyclohexane-1,2-dicarboxylic anhydride,1,2-cyclohexanedicarboxylic acid anhydride PubChem CID: 85689 ChEBI: CHEBI:103210 IUPAC Name: 3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione SMILES: O=C1OC(=O)C2CCCCC12
| PubChem CID | 85689 |
|---|---|
| CAS | 85-42-7 |
| Molecular Weight (g/mol) | 154.17 |
| ChEBI | CHEBI:103210 |
| MDL Number | MFCD00064863,MFCD00674195 |
| SMILES | O=C1OC(=O)C2CCCCC12 |
| Synonym | hexahydrophthalic anhydride,hexahydroisobenzofuran-1,3-dione,hhpa,1,2-cyclohexanedicarboxylic anhydride,lekutherm hardener h,hexahydrophthalic acid anhydride,1,3-isobenzofurandione, hexahydro,araldite ht 907,cyclohexane-1,2-dicarboxylic anhydride,1,2-cyclohexanedicarboxylic acid anhydride |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| InChI Key | MUTGBJKUEZFXGO-UHFFFAOYNA-N |
| Molecular Formula | C8H10O3 |
4-(Trifluoromethyl)phenylglyoxal hydrate, 98%, dry wt. basis
CAS: 1736-56-7 Molecular Formula: C9H5F3O2 Molecular Weight (g/mol): 202.132 MDL Number: MFCD05664098 InChI Key: BGOMXTCPIUNFKR-UHFFFAOYSA-N Synonym: 2-oxo-2-4-trifluoromethyl phenyl acetaldehyde,2-oxo-2-4-trifluoromethyl phenyl ethanal,2-oxidanylidene-2-4-trifluoromethyl phenyl ethanal,4-trifluoromethylphenyl oxo acetaldehyde,oxo 4-trifluoromethyl phenyl acetaldehyde,1-4-trifluoromethyl phenyl-1,2-ethanedione PubChem CID: 2783286 IUPAC Name: 2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde SMILES: C1=CC(=CC=C1C(=O)C=O)C(F)(F)F
| PubChem CID | 2783286 |
|---|---|
| CAS | 1736-56-7 |
| Molecular Weight (g/mol) | 202.132 |
| MDL Number | MFCD05664098 |
| SMILES | C1=CC(=CC=C1C(=O)C=O)C(F)(F)F |
| Synonym | 2-oxo-2-4-trifluoromethyl phenyl acetaldehyde,2-oxo-2-4-trifluoromethyl phenyl ethanal,2-oxidanylidene-2-4-trifluoromethyl phenyl ethanal,4-trifluoromethylphenyl oxo acetaldehyde,oxo 4-trifluoromethyl phenyl acetaldehyde,1-4-trifluoromethyl phenyl-1,2-ethanedione |
| IUPAC Name | 2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde |
| InChI Key | BGOMXTCPIUNFKR-UHFFFAOYSA-N |
| Molecular Formula | C9H5F3O2 |
4-(Bromomethyl)benzenesulfonyl chloride, 95%
CAS: 66176-39-4 Molecular Formula: C7H6BrClO2S Molecular Weight (g/mol): 269.537 MDL Number: MFCD00156129 InChI Key: QXTQWYZHHMQSQH-UHFFFAOYSA-N Synonym: 4-bromomethyl benzenesulfonyl chloride,4-bromomethyl benzene-1-sulfonyl chloride,4-bromomethyl benzenesulfonylchloride,alpha-bromo-p-toluenesulphonyl chloride,alpha-bromo-p-toluenesulfonyl chloride,4-bromomethyl benzenesulphonyl chloride,4-bromomethyl benzene-1-sulfonylchloride,buttpark 94\04-08,4-bromomethyl phenyl chlorosulfone,4-bromomethylene benzenesulfonyl chloride PubChem CID: 2734409 IUPAC Name: 4-(bromomethyl)benzenesulfonyl chloride SMILES: C1=CC(=CC=C1CBr)S(=O)(=O)Cl
| PubChem CID | 2734409 |
|---|---|
| CAS | 66176-39-4 |
| Molecular Weight (g/mol) | 269.537 |
| MDL Number | MFCD00156129 |
| SMILES | C1=CC(=CC=C1CBr)S(=O)(=O)Cl |
| Synonym | 4-bromomethyl benzenesulfonyl chloride,4-bromomethyl benzene-1-sulfonyl chloride,4-bromomethyl benzenesulfonylchloride,alpha-bromo-p-toluenesulphonyl chloride,alpha-bromo-p-toluenesulfonyl chloride,4-bromomethyl benzenesulphonyl chloride,4-bromomethyl benzene-1-sulfonylchloride,buttpark 94\04-08,4-bromomethyl phenyl chlorosulfone,4-bromomethylene benzenesulfonyl chloride |
| IUPAC Name | 4-(bromomethyl)benzenesulfonyl chloride |
| InChI Key | QXTQWYZHHMQSQH-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrClO2S |
1,2-Diiodotetrafluoroethane, 96%, stab. with copper
CAS: 354-65-4 Molecular Formula: C2F4I2 Molecular Weight (g/mol): 353.825 MDL Number: MFCD00039401 InChI Key: NZXVPCQHQVWOFD-UHFFFAOYSA-N Synonym: 1,2-diiodotetrafluoroethane,1,2-diiodoperfluoroethane,unii-2z13i2welk,ethane, 1,1,2,2-tetrafluoro-1,2-diiodo,2z13i2welk,acmc-1cknr PubChem CID: 67720 IUPAC Name: 1,1,2,2-tetrafluoro-1,2-diiodoethane SMILES: C(C(F)(F)I)(F)(F)I
| PubChem CID | 67720 |
|---|---|
| CAS | 354-65-4 |
| Molecular Weight (g/mol) | 353.825 |
| MDL Number | MFCD00039401 |
| SMILES | C(C(F)(F)I)(F)(F)I |
| Synonym | 1,2-diiodotetrafluoroethane,1,2-diiodoperfluoroethane,unii-2z13i2welk,ethane, 1,1,2,2-tetrafluoro-1,2-diiodo,2z13i2welk,acmc-1cknr |
| IUPAC Name | 1,1,2,2-tetrafluoro-1,2-diiodoethane |
| InChI Key | NZXVPCQHQVWOFD-UHFFFAOYSA-N |
| Molecular Formula | C2F4I2 |
4-Vinylbenzoic acid, 98%
CAS: 1075-49-6 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00002569 InChI Key: IRQWEODKXLDORP-UHFFFAOYSA-N Synonym: 4-vinylbenzoic acid,p-vinylbenzoic acid,4-carboxystyrene,benzoic acid, 4-ethenyl,styrene-4-carboxylic acid,4-vinyl-benzoic acid,p-vinyl benzoic acid,4-vinyl benzoic acid,para-vinyl benzoic acid,pubchem12624 PubChem CID: 14098 IUPAC Name: 4-ethenylbenzoic acid SMILES: C=CC1=CC=C(C=C1)C(=O)O
| PubChem CID | 14098 |
|---|---|
| CAS | 1075-49-6 |
| Molecular Weight (g/mol) | 148.161 |
| MDL Number | MFCD00002569 |
| SMILES | C=CC1=CC=C(C=C1)C(=O)O |
| Synonym | 4-vinylbenzoic acid,p-vinylbenzoic acid,4-carboxystyrene,benzoic acid, 4-ethenyl,styrene-4-carboxylic acid,4-vinyl-benzoic acid,p-vinyl benzoic acid,4-vinyl benzoic acid,para-vinyl benzoic acid,pubchem12624 |
| IUPAC Name | 4-ethenylbenzoic acid |
| InChI Key | IRQWEODKXLDORP-UHFFFAOYSA-N |
| Molecular Formula | C9H8O2 |
3-Amino-4-bromo-1H-pyrazole, 97%
CAS: 16461-94-2 Molecular Formula: C3H4BrN3 Molecular Weight (g/mol): 161.99 MDL Number: MFCD00082728 InChI Key: OELYMZVJDKSMOJ-UHFFFAOYSA-N Synonym: 3-amino-4-bromopyrazole,4-bromo-1h-pyrazol-3-amine,5-amino-4-bromo-1h-pyrazole,3-amino-4-bromo-1h-pyrazole,1h-pyrazol-3-amine, 4-bromo,4-bromo-2h-pyrazol-3-amine,4-bromo-1h-pyrazol-3-ylamine,4-bromo-2h-pyrazol-3-ylamine,4-bromopyrazole-5-ylamine,3-amino-4-bromo pound inverted question markpyrazole PubChem CID: 140079 IUPAC Name: 4-bromo-1H-pyrazol-5-amine SMILES: C1=NNC(=C1Br)N
| PubChem CID | 140079 |
|---|---|
| CAS | 16461-94-2 |
| Molecular Weight (g/mol) | 161.99 |
| MDL Number | MFCD00082728 |
| SMILES | C1=NNC(=C1Br)N |
| Synonym | 3-amino-4-bromopyrazole,4-bromo-1h-pyrazol-3-amine,5-amino-4-bromo-1h-pyrazole,3-amino-4-bromo-1h-pyrazole,1h-pyrazol-3-amine, 4-bromo,4-bromo-2h-pyrazol-3-amine,4-bromo-1h-pyrazol-3-ylamine,4-bromo-2h-pyrazol-3-ylamine,4-bromopyrazole-5-ylamine,3-amino-4-bromo pound inverted question markpyrazole |
| IUPAC Name | 4-bromo-1H-pyrazol-5-amine |
| InChI Key | OELYMZVJDKSMOJ-UHFFFAOYSA-N |
| Molecular Formula | C3H4BrN3 |
Methyl 4-aminobenzoate, 98%
CAS: 619-45-4 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.165 MDL Number: MFCD00007891 InChI Key: LZXXNPOYQCLXRS-UHFFFAOYSA-N Synonym: 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester PubChem CID: 12082 IUPAC Name: methyl 4-aminobenzoate SMILES: COC(=O)C1=CC=C(C=C1)N
| PubChem CID | 12082 |
|---|---|
| CAS | 619-45-4 |
| Molecular Weight (g/mol) | 151.165 |
| MDL Number | MFCD00007891 |
| SMILES | COC(=O)C1=CC=C(C=C1)N |
| Synonym | 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester |
| IUPAC Name | methyl 4-aminobenzoate |
| InChI Key | LZXXNPOYQCLXRS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Polystyrene latex microsphere, carboxylated, 0.35 micron, 2.5 wt% dispersion in water
CAS: 9003-53-6 Molecular Formula: (C8H8)n Molecular Weight (g/mol): 104.15 MDL Number: MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: ethenylbenzene SMILES: *-CC(-*)C1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 9003-53-6 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00084450 |
| SMILES | *-CC(-*)C1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | ethenylbenzene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | (C8H8)n |
Polyvinylpyrrolidone-iodine complex
CAS: 25655-41-8 Molecular Formula: (C6H9NO)nI2 Molecular Weight (g/mol): 364.95 MDL Number: MFCD00084483 InChI Key: CPKVUHPKYQGHMW-UHFFFAOYSA-N Synonym: povidone iodine,povidone-iodine,betadine,isodine,pvp iodine,pvp-iodine,pvp-i,isobetadyne,bridine,disphex PubChem CID: 410087 SMILES: II.*-CC(-*)N1CCCC1=O
| PubChem CID | 410087 |
|---|---|
| CAS | 25655-41-8 |
| Molecular Weight (g/mol) | 364.95 |
| MDL Number | MFCD00084483 |
| SMILES | II.*-CC(-*)N1CCCC1=O |
| Synonym | povidone iodine,povidone-iodine,betadine,isodine,pvp iodine,pvp-iodine,pvp-i,isobetadyne,bridine,disphex |
| InChI Key | CPKVUHPKYQGHMW-UHFFFAOYSA-N |
| Molecular Formula | (C6H9NO)nI2 |
Polyethylene glycol dimethacrylate, M.W. 8,000
CAS: 25852-47-5 MDL Number: MFCD00081877 Synonym: ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate
| CAS | 25852-47-5 |
|---|---|
| MDL Number | MFCD00081877 |
| Synonym | ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate |
1,4-Diazabicyclo[3.2.2]nonane, 95%
CAS: 283-38-5 Molecular Formula: C7H14N2 Molecular Weight (g/mol): 126.2 InChI Key: XJKNACDCUAFDHD-UHFFFAOYSA-N Synonym: 1,4-diazabicyclo 3.2.2 nonane,1,4-diazobicylco 3.2.2 nonane,1,4-diaza-bicyclo 3.2.2 nonane,1,4-diazabicyclo-3.2.2 nonane,1,4-diazabicyclo 3.2.2 _nonane,1,4-diazabicyclo 3.2.2-nonane PubChem CID: 398407 IUPAC Name: 1,4-diazabicyclo[3.2.2]nonane SMILES: C1CN2CCC1NCC2
| PubChem CID | 398407 |
|---|---|
| CAS | 283-38-5 |
| Molecular Weight (g/mol) | 126.2 |
| SMILES | C1CN2CCC1NCC2 |
| Synonym | 1,4-diazabicyclo 3.2.2 nonane,1,4-diazobicylco 3.2.2 nonane,1,4-diaza-bicyclo 3.2.2 nonane,1,4-diazabicyclo-3.2.2 nonane,1,4-diazabicyclo 3.2.2 _nonane,1,4-diazabicyclo 3.2.2-nonane |
| IUPAC Name | 1,4-diazabicyclo[3.2.2]nonane |
| InChI Key | XJKNACDCUAFDHD-UHFFFAOYSA-N |
| Molecular Formula | C7H14N2 |